On Target CAPSD_HCV77 0.32365146/CHEMBL4112685
For the given ligand Galidesivir triphosphate form, we have found in our database that, being scored 0.32365146, the most similar ligand is CHEMBL4112685. Check out the elaboration below.
| Galidesivir triphosphate form (Given Ligand) | CHEMBL4112685 (Similar Ligand) |
|---|---|
| Nc2ncnc3c(C1NC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C(O)C1O)c[nH]c23 | C[C@H](CC(N)=O)N[C@H](CC1CC1)c1ccc(Cl)c(C(=O)c2ccc(N)nc2)c1F |
|
|
|
|
|
|
| 1000080a 0180c800 20500502 c8880e30 002c01c4 0012c030 0080e000 02001880 00500900 000800c0 61300004 48011000 08000802 01a20820 002e0440 000c060c 190e00a8 02000006 01e02400 40203203 40000100 1c008860 278000c0 00400010 40046001 c0000100 0a008080 80050004 0040010a 00460016 61408280 c000a6e2 | 080080c2 01804c00 00104182 c2010610 00041201 00000010 30002000 23001000 00400800 00080fc0 08300004 4001ba00 0e008866 01201004 00000500 080c000c 03010200 03000004 00202410 00200201 c0000502 1c068700 21800800 3070001c 00043000 e0000200 08040080 d0800181 0040018a 00068012 a4040000 00022600 |