On Target NA_A-H3N8 0.25233644/CHEMBL4285767
For the given ligand Galidesivir, we have found in our database that, being scored 0.25233644, the most similar ligand is CHEMBL4285767. Check out the elaboration below.
| Galidesivir (Given Ligand) | CHEMBL4285767 (Similar Ligand) |
|---|---|
| Nc2ncnc3c(C1NC(CO)C(O)C1O)c[nH]c23 | CCc1ccc(CN[C@H]2CC(C(=O)O)=C[C@@H](OC(CC)CC)[C@@H]2NC(C)=O)cc1 |
|
|
|
|
|
|
| 1000000a 0180c800 00100102 c8880630 002c01c0 0000c010 0000e000 02001800 00500900 000800c0 61300004 40011000 08000802 01a00800 002c0440 000c000c 18020008 02000004 01e02400 40200201 40000100 18008860 278000c0 00400010 00046001 c0000000 08008080 80000004 0040010a 00460002 60008200 800006e0 | 00070040 09007000 00100100 84010700 00180080 00000800 02080180 3a00140a 11000100 001908c8 48200000 41019801 8402881a 01882000 00001408 00081008 10a04000 02000060 60c12010 00000201 00000020 38048e80 13008080 02500018 10001401 c0001400 00c04000 90000001 0c000300 00060403 24060000 00800e10 |