On Target PLP_SARS 0.2025862/CHEMBL358279
For the given ligand Galidesivir triphosphate form, we have found in our database that, being scored 0.2025862, the most similar ligand is CHEMBL358279. Check out the elaboration below.
| Galidesivir triphosphate form (Given Ligand) | CHEMBL358279 (Similar Ligand) |
|---|---|
| Nc2ncnc3c(C1NC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C(O)C1O)c[nH]c23 | NC(=O)c1ccc2c(c1)C(=O)C(=O)N2Cc1ccc2ccccc2c1 |
|
|
|
|
|
|
| 1000080a 0180c800 20500502 c8880e30 002c01c4 0012c030 0080e000 02001880 00500900 000800c0 61300004 48011000 08000802 01a20820 002e0440 000c060c 190e00a8 02000006 01e02400 40203203 40000100 1c008860 278000c0 00400010 40046001 c0000100 0a008080 80050004 0040010a 00460016 61408280 c000a6e2 | 1000c002 00800800 00100100 80010600 20001001 00010040 00800000 02081000 04800080 00080e40 08280004 4000f000 03008802 00108000 40020540 08080008 00048000 02000000 08000400 00000200 c0100400 18228608 20012000 8144001d 00000000 c0000280 08000010 80005080 04088100 00060003 a0047000 20000600 |