On Target NA_A-H3N8 0.21176471/CHEMBL4285767
For the given ligand Galidesivir triphosphate form, we have found in our database that, being scored 0.21176471, the most similar ligand is CHEMBL4285767. Check out the elaboration below.
| Galidesivir triphosphate form (Given Ligand) | CHEMBL4285767 (Similar Ligand) |
|---|---|
| Nc2ncnc3c([C@@H]1N[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)[O-])[C@@H](O)[C@H]1O)c[nH]c23 | CCc1ccc(CN[C@H]2CC(C(=O)O)=C[C@@H](OC(CC)CC)[C@@H]2NC(C)=O)cc1 |
|
|
|
|
|
|
| 1000080a 0180c800 20500502 c8880e30 002c01c4 0012c030 0080e000 02001880 00500900 000800c0 61300004 48011000 08000802 01a20820 002e0440 000c060c 190e00a8 02000006 01e02400 40203203 40000100 1c008860 278000c0 00400010 40046001 c0000100 0a008080 80050004 0040010a 00460016 61408280 c000a6e2 | 00070040 09007000 00100100 84010700 00180080 00000800 02080180 3a00140a 11000100 001908c8 48200000 41019801 8402881a 01882000 00001408 00081008 10a04000 02000060 60c12010 00000201 00000020 38048e80 13008080 02500018 10001401 c0001400 00c04000 90000001 0c000300 00060403 24060000 00800e10 |