On Target DPM_HHV1K 0.14574899/CHEMBL481172
For the given ligand Tenofovir, we have found in our database that, being scored 0.14574899, the most similar ligand is CHEMBL481172. Check out the elaboration below.
| Tenofovir (Given Ligand) | CHEMBL481172 (Similar Ligand) |
|---|---|
| C[C@H](Cn2cnc1c(N)ncnc12)OCP(=O)(O)O | CN(Cc1cc2c(=O)c(C(=O)NCc3ccc(Cl)cc3)cn(C)c2o1)C[C@@H](O)c1ccco1 |
|
|
|
|
|
|
| 0000000a 00901800 80080000 48080620 00080041 0000c100 00008002 00000800 00400108 00000080 0000800c 40019000 00001000 00820000 00081080 300ec00c 00200028 00000000 10400000 80200000 80000080 15400050 23800040 04000014 00000000 00000000 00000200 08014030 00000208 00460000 c0080000 000080c4 | 1041818a 00a2d800 80184101 00014610 04041683 80004000 00004400 4a281200 020841e1 800808d0 01200434 4001b802 c6089c6e 01600188 00004460 000c040c 10026000 c200c004 02200080 08000200 c0000000 1a268f10 22a04000 a159001c 30842070 e0000402 0c940054 98040000 24402101 03860043 e0140000 80020600 |