On Target RT_HIV1 0.32967034/CHEMBL4108139
For the given ligand Galidesivir, we have found in our database that, being scored 0.32967034, the most similar ligand is CHEMBL4108139. Check out the elaboration below.
| Galidesivir (Given Ligand) | CHEMBL4108139 (Similar Ligand) |
|---|---|
| Nc2ncnc3c([C@@H]1N[C@H](CO)[C@@H](O)[C@H]1O)c[nH]c23 | COC(=O)NC(C(=O)N[C@H](c1ccc([C@@H](CO)N(C(C)C)S(=O)(=O)c2ccc(N)cc2)s1)C(F)(F)F)[C@@H](c1ccccc1)c1c[nH]c2ncccc12 |
|
|
|
|
|
|
| 1000000a 0180c800 00100102 c8880630 002c01c0 0000c010 0000e000 02001800 00500900 000800c0 61300004 40011000 08000802 01a00800 002c0440 000c000c 18020008 02000004 01e02400 40200201 40000100 18008860 278000c0 00400010 00046001 c0000000 08008080 80000004 0040010a 00460002 60008200 800006e0 | 08010012 00903a00 03184100 45b10611 100c12d0 0003e0e0 04003081 2300500e 00c60b08 c04918c0 29302204 e000b880 9c008812 00e02821 80242440 001e020c 18433000 0219000c 00700418 4000620d c0001900 78288eb0 23900000 db700058 42043800 e4010006 48000840 d040206c 0c200780 2046000f e0044200 00c107e0 |