On Target NA_A-H3N8 0.14666666/CHEMBL222813
For the given ligand Tenofovir, we have found in our database that, being scored 0.14666666, the most similar ligand is CHEMBL222813. Check out the elaboration below.
| Tenofovir (Given Ligand) | CHEMBL222813 (Similar Ligand) |
|---|---|
| C[C@H](Cn2cnc1c(N)ncnc12)OCP(=O)(O)O | CC(=O)N[C@@H]1[C@@H](NC(=N)N)C=C(C(=O)O)O[C@H]1[C@H](O)[C@H](O)CO |
|
|
|
|
|
|
| 0000000a 00901800 80080000 48080620 00080041 0000c100 00008002 00000800 00400108 00000080 0000800c 40019000 00001000 00820000 00081080 300ec00c 00200028 00000000 10400000 80200000 80000080 15400050 23800040 04000014 00000000 00000000 00000200 08014030 00000208 00460000 c0080000 000080c4 | 00000000 8904f200 00100101 84010d01 003c00c1 00200200 00080180 38802c08 01000600 011000ca 80200000 4001c000 8002b002 01892000 02001408 391b9008 30210814 80000540 51c16010 00002201 00000020 70152fb0 17008080 0a10001c 00021403 88008c00 40c04000 90000121 0800c250 00040401 ac0e0000 00004a00 |