On Target NSP15_SARS 0.14044943/CHEMBL2441741
For the given ligand Tenofovir, we have found in our database that, being scored 0.14044943, the most similar ligand is CHEMBL2441741. Check out the elaboration below.
| Tenofovir (Given Ligand) | CHEMBL2441741 (Similar Ligand) |
|---|---|
| C[C@H](Cn2cnc1c(N)ncnc12)OCP(=O)(O)O | CC(C)C[C@H](NC(=O)[C@H](Cc1cccc2ccccc12)NC(=O)OCc1ccccc1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 0000000a 00901800 80080000 48080620 00080041 0000c100 00008002 00000800 00400108 00000080 0000800c 40019000 00001000 00820000 00081080 300ec00c 00200028 00000000 10400000 80200000 80000080 15400050 23800040 04000014 00000000 00000000 00000200 08014030 00000208 00460000 c0080000 000080c4 | 01030000 01403200 00100100 04010600 00000000 0001c010 00000000 2000000c 00e00b00 000a08c0 08300000 4003b000 0e00801a 00012001 80000000 021e0008 00020000 02080400 00002898 00000201 00000100 38240e38 00000003 83500018 00000800 80002002 00000000 10200020 0c000200 0006000b e0004000 00802600 |