On Target NP_HCoV-OC43 0.09219858/CHEMBL3233481
For the given ligand Tenofovir, we have found in our database that, being scored 0.09219858, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| Tenofovir (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| C[C@H](Cn2cnc1c(N)ncnc12)OCP(=O)(O)O | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 0000000a 00901800 80080000 48080620 00080041 0000c100 00008002 00000800 00400108 00000080 0000800c 40019000 00001000 00820000 00081080 300ec00c 00200028 00000000 10400000 80200000 80000080 15400050 23800040 04000014 00000000 00000000 00000200 08014030 00000208 00460000 c0080000 000080c4 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |