On Target PA_INFA 0.2173913/CHEMBL4566537
For the given ligand Ribavirin, we have found in our database that, being scored 0.2173913, the most similar ligand is CHEMBL4566537. Check out the elaboration below.
| Ribavirin (Given Ligand) | CHEMBL4566537 (Similar Ligand) |
|---|---|
| NC(=O)c2ncn([C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O)n2 | Cc1cc(=O)c(O)cn1C1CCOCC1 |
|
|
|
|
|
|
| 00000004 01400008 c0100000 80010400 013800c0 00008004 00c00000 00000401 00000110 818000a0 08190028 44018810 00008000 03a00100 002a1080 001aa00c 00008000 00000002 19d00000 00201201 80180020 10000650 27014000 0e000410 10200410 40000402 00000800 31020060 01000305 00040001 80000080 00008108 | 00000002 01000008 60104100 10010700 800c0028 00000044 04800000 00200000 02000000 808000c0 00000004 40018000 00008804 00480000 00020000 020c000c 00200000 02004000 00e00000 00060001 40000020 18008010 21800000 00500010 00002400 c0000000 00020260 10040000 00000204 00060000 00000000 40000000 |