On Target NS5B_HCV1A 0.20571429/CHEMBL163917
For the given ligand Ribavirin, we have found in our database that, being scored 0.20571429, the most similar ligand is CHEMBL163917. Check out the elaboration below.
| Ribavirin (Given Ligand) | CHEMBL163917 (Similar Ligand) |
|---|---|
| NC(=O)c2ncn([C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O)n2 | CC(C)C[C@H](NC(=O)[C@H](CCC(=O)O)NC(=O)OC(C)(C)C)C(=O)N[C@@H](CC(F)F)C(=O)C(=O)O |
|
|
|
|
|
|
| 00000004 01400008 c0100000 80010400 013800c0 00008004 00c00000 00000401 00000110 818000a0 08190028 44018810 00008000 03a00100 002a1080 001aa00c 00008000 00000002 19d00000 00201201 80180020 10000650 27014000 0e000410 10200410 40000402 00000800 31020060 01000305 00040001 80000080 00008108 | 00030000 01403000 00100000 04000600 00181000 00018000 00000000 20000008 04800200 00020080 00200000 4001f000 0e008032 01002001 80000000 001a0408 000a0000 00080001 00c00810 00000201 00000000 30140e50 01000083 02100018 00001001 00000082 00000060 90200020 08000200 02040001 a0004000 00802a00 |