On Target NS5B_HCV1B 0.33739838/CHEMBL3645200
For the given ligand Galidesivir, we have found in our database that, being scored 0.33739838, the most similar ligand is CHEMBL3645200. Check out the elaboration below.
| Galidesivir (Given Ligand) | CHEMBL3645200 (Similar Ligand) |
|---|---|
| Nc2ncnc3c([C@@H]1N[C@H](CO)[C@@H](O)[C@H]1O)c[nH]c23 | CNC(=O)c1c2cc(C3CC3)c(N(CCCNC(=O)c3cccnc3)S(C)(=O)=O)cc2nn1-c1ccc(Br)cc1 |
|
|
|
|
|
|
| 1000000a 0180c800 00100102 c8880630 002c01c0 0000c010 0000e000 02001800 00500900 000800c0 61300004 40011000 08000802 01a00800 002c0440 000c000c 18020008 02000004 01e02400 40200201 40000100 18008860 278000c0 00400010 00046001 c0000000 08008080 80000004 0040010a 00460002 60008200 800006e0 | 10004006 0080de08 20184902 41310e10 210c1000 00004042 02044000 02001408 00100900 004909e0 09312024 40118800 80008c33 01400201 808a0440 000e200e 04268000 02000004 08600008 00225203 e0100101 1c8f8e38 2080c800 9360001c 02144080 c0000048 08270080 8000108c 0c488104 0046005b e4048088 a81147e0 |