On Target CAPSD_HCV77 0.278481/CHEMBL3696817
For the given ligand Ribavirin, we have found in our database that, being scored 0.278481, the most similar ligand is CHEMBL3696817. Check out the elaboration below.
| Ribavirin (Given Ligand) | CHEMBL3696817 (Similar Ligand) |
|---|---|
| NC(=O)c2ncn([C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O)n2 | COc1nc(N)nc2c1ncn2[C@@H]1O[C@@H]2COP(=O)(OC(C)C)O[C@H]2[C@@]1(C)N |
|
|
|
|
|
|
| 00000004 01400008 c0100000 80010400 013800c0 00008004 00c00000 00000401 00000110 818000a0 08190028 44018810 00008000 03a00100 002a1080 001aa00c 00008000 00000002 19d00000 00201201 80180020 10000650 27014000 0e000410 10200410 40000402 00000800 31020060 01000305 00040001 80000080 00008108 | 0000400a 01c01818 60080318 c1810f00 80180064 0008c004 1400ec41 80403808 00404100 818000f0 0c00900c 40059000 00001104 0b8a0120 01881884 101d8e0c 002e0020 00800008 39c00000 00247003 800a0020 3c000850 27800840 08400814 18000c40 40000202 0e060200 10010060 00000208 0046101c d1e84000 08298080 |