On Target NA_A-H3N8 0.3115942/CHEMBL4285029
For the given ligand Ritonavir, we have found in our database that, being scored 0.3115942, the most similar ligand is CHEMBL4285029. Check out the elaboration below.
| Ritonavir (Given Ligand) | CHEMBL4285029 (Similar Ligand) |
|---|---|
| CC(C)c4nc(CN(C)C(=O)N[C@H](C(=O)N[C@@H](Cc1ccccc1)C[C@H](O)[C@H](Cc2ccccc2)NC(=O)OCc3cncs3)C(C)C)cs4 | CCC(CC)O[C@@H]1C=C(C(=O)O)C[C@H](NCc2ccc(-c3cc4ccccc4s3)cc2)[C@H]1NC(C)=O |
|
|
|
|
|
|
| 0103000a 01407000 1010090a 34010e10 000800c2 00128002 00002084 2001f00f 10600b80 004a08c0 08318a00 f003b000 0400b052 00212001 00022000 001e002c 0002c010 020804a0 00c12850 8100ca41 80002900 783d1ed0 231000c9 9351001c 02051001 8c008802 00200001 90221004 0c081206 04061003 a0024000 a0092601 | 00072040 19007000 00100100 84010700 00180080 00000800 020c0180 3a10140a 11000100 001108c9 40200200 41019281 8402881a 01882000 00003488 00081008 10a24000 02000068 64c12010 10000201 00000020 78048e88 33008080 02500018 12001403 c4001400 00c04000 90000245 0c004308 00060401 24060000 00c10e10 |