On Target PA_INFA 0.3147541/CHEMBL4473580
For the given ligand Ritonavir, we have found in our database that, being scored 0.3147541, the most similar ligand is CHEMBL4473580. Check out the elaboration below.
| Ritonavir (Given Ligand) | CHEMBL4473580 (Similar Ligand) |
|---|---|
| CC(C)c4nc(CN(C)C(=O)N[C@H](C(=O)N[C@@H](Cc1ccccc1)C[C@H](O)[C@H](Cc2ccccc2)NC(=O)OCc3cncs3)C(C)C)cs4 | CCOC(=O)c1cn2c(c(O)c1=O)C(=O)N(CCOC)C[C@@H]2C(c1ccccc1)c1ccccc1 |
|
|
|
|
|
|
| 0103000a 01407000 1010090a 34010e10 000800c2 00128002 00002084 2001f00f 10600b80 004a08c0 08318a00 f003b000 0400b052 00212001 00022000 001e002c 0002c010 020804a0 00c12850 8100ca41 80002900 783d1ed0 231000c9 9351001c 02051001 8c008802 00200001 90221004 0c081206 04061003 a0024000 a0092601 | 0000001a 4880fe08 70104100 50050e10 040410ba 0012c144 0c000000 23203401 12300900 801908d8 08390004 40018000 80009906 08510000 001a1c80 2a0c210c 10024000 82084006 00210000 00060201 c0000321 382f8e50 32802000 c350001c 08152400 e0002080 08c80060 d0040001 0c440384 0406005b e40c0000 40004600 |