On Target RT_HIV1 0.47368422/CHEMBL3683703
For the given ligand Nirmatrelvir Modify, we have found in our database that, being scored 0.47368422, the most similar ligand is CHEMBL3683703. Check out the elaboration below.
| Nirmatrelvir Modify (Given Ligand) | CHEMBL3683703 (Similar Ligand) |
|---|---|
| CC(C)(c1ccccc1)C(NC(=O)C(F)(F)F)C(=O)N2CC4C(C2C(=O)NC(C#N)CC3CCNC3=O)C4(C)C | CCCCCN([C@H](CO)CCC(F)(F)CNC(=O)[C@@H](NC(=O)OC)C(c1ccccc1)c1ccccc1)S(=O)(=O)c1ccc(CO)cc1 |
|
|
|
|
|
|
| 00030000 01003200 00100100 04010600 00000000 000000d0 10000000 2000000c 00200880 800808c0 08300000 5003b000 0600801a 01402001 80000000 000c0008 00400000 02000000 00002008 00000205 00000100 38240630 03000403 83700018 00000800 80000000 00000100 90000000 0c000000 0006000b 20004000 00802780 | 00000010 09803200 01100100 05b10600 00081088 0001e0c0 00000000 2100000c 00c40b00 804808c0 08302000 6001b000 0c008002 00c02001 80680000 001e0008 10022000 02080000 00402018 00006601 80000100 38340e30 03100001 db700058 02000800 a0000006 00000020 d000002c 0c000680 2606000b e0004000 00012670 |