On Target NS5B_HCV1B 0.26086956/CHEMBL99408
For the given ligand jj, we have found in our database that, being scored 0.26086956, the most similar ligand is CHEMBL99408. Check out the elaboration below.
| jj (Given Ligand) | CHEMBL99408 (Similar Ligand) |
|---|---|
| CN(C(=O)Nc1ccccc1)c2ccccc2 | Nc1ccc2ncccc2c1 |
|
|
|
|
|
|
| 00000006 00000000 00000000 00000a40 00000000 00000000 00000000 00002001 00000000 00000840 00280004 00008000 00008000 00100000 00000040 00000000 00040000 00000000 08000000 00000000 40000100 08000400 20022000 00000000 00100000 00000000 00000000 00000080 00008000 00060001 00000000 00004000 | 00000002 00800000 00004000 00000200 00040000 00000000 00000000 00000000 00000000 00000840 00000004 00008000 00000800 00400000 00000040 00040004 00000000 00000008 00200000 00000000 40000000 08008008 20800000 80000000 00000000 00000000 00000000 00000000 00000000 00060000 00040000 00000000 |