On Target NA_A-H3N8 0.06875/CHEMBL4285767
For the given ligand jj, we have found in our database that, being scored 0.06875, the most similar ligand is CHEMBL4285767. Check out the elaboration below.
| jj (Given Ligand) | CHEMBL4285767 (Similar Ligand) |
|---|---|
| CN(C(=O)Nc1ccccc1)c2ccccc2 | CCc1ccc(CN[C@H]2CC(C(=O)O)=C[C@@H](OC(CC)CC)[C@@H]2NC(C)=O)cc1 |
|
|
|
|
|
|
| 00000006 00000000 00000000 00000a40 00000000 00000000 00000000 00002001 00000000 00000840 00280004 00008000 00008000 00100000 00000040 00000000 00040000 00000000 08000000 00000000 40000100 08000400 20022000 00000000 00100000 00000000 00000000 00000080 00008000 00060001 00000000 00004000 | 00070040 09007000 00100100 84010700 00180080 00000800 02080180 3a00140a 11000100 001908c8 48200000 41019801 8402881a 01882000 00001408 00081008 10a04000 02000060 60c12010 00000201 00000020 38048e80 13008080 02500018 10001401 c0001400 00c04000 90000001 0c000300 00060403 24060000 00800e10 |