On Target PLP_SARS 0.19491525/CHEMBL358279
For the given ligand jj, we have found in our database that, being scored 0.19491525, the most similar ligand is CHEMBL358279. Check out the elaboration below.
| jj (Given Ligand) | CHEMBL358279 (Similar Ligand) |
|---|---|
| CN(C(=O)Nc1ccccc1)c2ccccc2 | NC(=O)c1ccc2c(c1)C(=O)C(=O)N2Cc1ccc2ccccc2c1 |
|
|
|
|
|
|
| 00000006 00000000 00000000 00000a40 00000000 00000000 00000000 00002001 00000000 00000840 00280004 00008000 00008000 00100000 00000040 00000000 00040000 00000000 08000000 00000000 40000100 08000400 20022000 00000000 00100000 00000000 00000000 00000080 00008000 00060001 00000000 00004000 | 1000c002 00800800 00100100 80010600 20001001 00010040 00800000 02081000 04800080 00080e40 08280004 4000f000 03008802 00108000 40020540 08080008 00048000 02000000 08000400 00000200 c0100400 18228608 20012000 8144001d 00000000 c0000280 08000010 80005080 04088100 00060003 a0047000 20000600 |