On Target NA_INFB 0.12751678/CHEMBL81286
For the given ligand jj, we have found in our database that, being scored 0.12751678, the most similar ligand is CHEMBL81286. Check out the elaboration below.
| jj (Given Ligand) | CHEMBL81286 (Similar Ligand) |
|---|---|
| c3ccc(COc1ccccc1OCc2ccccc2)cc3 | CC[C@@H](CCc1ccccc1)O[C@@H]1C=C(C(=O)O)C[C@H](N)[C@H]1NC(C)=O |
|
|
|
|
|
|
| 04000000 00000008 20000108 00210200 00001000 00004000 02000000 00000000 00000100 00000840 00000000 40008000 00804002 00010000 01000001 02088008 00000000 02000000 00400000 00020000 00000000 08000020 00000000 00c01000 00000000 80002000 00000000 00000000 00000200 00020008 40000000 00000000 | 00070040 09007008 00100102 80010700 00180080 00000800 02080180 38000402 11000800 001808c8 48300000 41019001 0402801a 01a80000 00001408 00081008 10a04000 02000060 60c12010 00000201 00000120 38040e80 13008040 02500018 10001400 80001400 00c04000 90000001 0c000202 00060403 04020000 00000610 |