On Target CAPSD_HCV77 0.23300971/CHEMBL4107993
For the given ligand jj, we have found in our database that, being scored 0.23300971, the most similar ligand is CHEMBL4107993. Check out the elaboration below.
| jj (Given Ligand) | CHEMBL4107993 (Similar Ligand) |
|---|---|
| c3ccc(COc1ccccc1OCc2ccccc2)cc3 | CC[C@@H](N)c1ccc(OC)c(C(=O)c2ccccc2)c1F |
|
|
|
|
|
|
| 04000000 00000008 20000108 00210200 00001000 00004000 02000000 00000000 00000100 00000840 00000000 40008000 00804002 00010000 01000001 02088008 00000000 02000000 00400000 00020000 00000000 08000020 00000000 00c01000 00000000 80002000 00000000 00000000 00000200 00020008 40000000 00000000 | 00000040 00000808 20100108 02010600 00001201 00020010 02040000 01001200 00000800 00088e40 08100000 40008200 00008842 00001000 01000001 08082008 03000200 02000000 00000400 00020001 00000100 18028200 01000000 12400014 00000000 e0000000 08320800 40800001 00000380 00068002 82040010 00000600 |