On Target ACE2_HUMAN 0.125/CHEMBL258333
For the given ligand jj, we have found in our database that, being scored 0.125, the most similar ligand is CHEMBL258333. Check out the elaboration below.
| jj (Given Ligand) | CHEMBL258333 (Similar Ligand) |
|---|---|
| O=C(Nc1ccccc1)Nc2ccccc2 | O=C(CS)N[C@@H](Cc1ccc(-c2ccccc2)cc1)C(=O)O |
|
|
|
|
|
|
| 00000006 00000000 00000000 00000a40 00000000 00000000 00000000 00002001 00000000 00000840 00280004 00008000 00008000 00100000 00000040 00000000 00040000 00000000 08000000 00000000 40000100 08000400 20022000 00000000 00100000 00000000 00000000 00000080 00008000 00060001 00000000 00004000 | 00002000 00005000 00100100 00110600 00000080 00000000 80000000 00000004 00000980 020a0840 08300000 4000b800 06008002 00040000 00000000 00080008 10020000 02000000 04400008 10000201 00000100 18200e00 13000040 85400018 00000800 80000000 00000000 00000040 04004000 00060003 20004000 02010600 |