On Target PA_INFA 0.21818182/CHEMBL2070214
For the given ligand jj, we have found in our database that, being scored 0.21818182, the most similar ligand is CHEMBL2070214. Check out the elaboration below.
| jj (Given Ligand) | CHEMBL2070214 (Similar Ligand) |
|---|---|
| O=C(Nc1ccccc1)Nc2ccccc2 | O=C(NCCc1ccc(O)c(O)c1)c1cc2cc(O)c(O)cc2[nH]1 |
|
|
|
|
|
|
| 00000006 00000000 00000000 00000a40 00000000 00000000 00000000 00002001 00000000 00000840 00280004 00008000 00008000 00100000 00000040 00000000 00040000 00000000 08000000 00000000 40000100 08000400 20022000 00000000 00100000 00000000 00000000 00000080 00008000 00060001 00000000 00004000 | 00000002 42009808 20100100 10010e00 00040020 80100000 06000000 02003005 00000080 00080840 08290004 40008000 00008806 00500000 00020440 0204810c 00000000 02000006 00200000 00060200 40000000 18278608 20802000 8140001c 00102000 c0000000 00120000 80000000 04000104 00060003 a0040200 00244600 |