On Target RDRP_SARS2 0.0701107/CHEMBL4065616
For the given ligand jj, we have found in our database that, being scored 0.0701107, the most similar ligand is CHEMBL4065616. Check out the elaboration below.
| jj (Given Ligand) | CHEMBL4065616 (Similar Ligand) |
|---|---|
| O=C(Nc1ccccc1)Nc2ccccc2 | CCC(COC(=O)[C@@H](NP(=O)(Oc1ccccc1)OC[C@H]1O[C@@]([C@@H]([C@@H]1O)O)(C#N)c1ccc2n1ncnc2N)C)CC |
|
|
|
|
|
|
| 00000006 00000000 00000000 00000a40 00000000 00000000 00000000 00002001 00000000 00000840 00280004 00008000 00008000 00100000 00000040 00000000 00040000 00000000 08000000 00000000 40000100 08000400 20022000 00000000 00100000 00000000 00000000 00000080 00008000 00060001 00000000 00004000 | 0020004a 81144109 f2103512 99010f60 452c80f4 8008c004 0303c401 00200a20 19404b00 010c0844 08189004 4ac7b168 00009802 02b30020 000e9040 028eba8c 084b8830 06800005 21662008 00665243 60120120 3e008a60 a7801cc6 08700110 10000400 80002000 0f0892c0 900388a0 0240128f 00c6cc36 55400280 22339c84 |