On Target ACE2_HUMAN 0.1826087/CHEMBL258333
For the given ligand JJJ002, we have found in our database that, being scored 0.1826087, the most similar ligand is CHEMBL258333. Check out the elaboration below.
| JJJ002 (Given Ligand) | CHEMBL258333 (Similar Ligand) |
|---|---|
| O=C(Nc1ccccc1)N(Cc2ccccc2)c3ccccc3 | O=C(CS)N[C@@H](Cc1ccc(-c2ccccc2)cc1)C(=O)O |
|
|
|
|
|
|
| 00004006 00800000 00000100 00010e40 00000000 00000000 00000004 02003001 00000000 00000840 01280004 4000c000 00008800 00100000 00000040 00000000 00044000 02400000 08000000 00000000 c0100100 08018400 20032000 00400008 00100000 80000000 00000000 80000080 00008100 00060001 00040000 80004200 | 00002000 00005000 00100100 00110600 00000080 00000000 80000000 00000004 00000980 020a0840 08300000 4000b800 06008002 00040000 00000000 00080008 10020000 02000000 04400008 10000201 00000100 18200e00 13000040 85400018 00000800 80000000 00000000 00000040 04004000 00060003 20004000 02010600 |