On Target PA_INFA 0.338843/CHEMBL2070214
For the given ligand JJJ002, we have found in our database that, being scored 0.338843, the most similar ligand is CHEMBL2070214. Check out the elaboration below.
| JJJ002 (Given Ligand) | CHEMBL2070214 (Similar Ligand) |
|---|---|
| O=C(Nc1ccccc1)N(Cc2ccccc2)c3ccccc3 | O=C(NCCc1ccc(O)c(O)c1)c1cc2cc(O)c(O)cc2[nH]1 |
|
|
|
|
|
|
| 00004006 00800000 00000100 00010e40 00000000 00000000 00000004 02003001 00000000 00000840 01280004 4000c000 00008800 00100000 00000040 00000000 00044000 02400000 08000000 00000000 c0100100 08018400 20032000 00400008 00100000 80000000 00000000 80000080 00008100 00060001 00040000 80004200 | 00000002 42009808 20100100 10010e00 00040020 80100000 06000000 02003005 00000080 00080840 08290004 40008000 00008806 00500000 00020440 0204810c 00000000 02000006 00200000 00060200 40000000 18278608 20802000 8140001c 00102000 c0000000 00120000 80000000 04000104 00060003 a0040200 00244600 |