On Target PR_HIV1 0.13661203/CHEMBL523528
For the given ligand JJJ002, we have found in our database that, being scored 0.13661203, the most similar ligand is CHEMBL523528. Check out the elaboration below.
| JJJ002 (Given Ligand) | CHEMBL523528 (Similar Ligand) |
|---|---|
| O=C(Nc1ccccc1)N(Cc2ccccc2)c3ccccc3 | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC2COCOC2)cc1 |
|
|
|
|
|
|
| 00004006 00800000 00000100 00010e40 00000000 00000000 00000004 02003001 00000000 00000840 01280004 4000c000 00008800 00100000 00000040 00000000 00044000 02400000 08000000 00000000 c0100100 08018400 20032000 00400008 00100000 80000000 00000000 80000080 00008100 00060001 00040000 80004200 | 00000010 01c05409 2110050a 01b10600 00081080 00028000 02802800 20000004 00742a00 014809e0 08302000 60018010 00008002 00200001 81e80001 003a0008 10022000 02080000 01400800 01027603 80100100 18280c90 07100040 d9500058 02000000 8000000e 00800000 342000cc 04000600 20060013 80000000 00012670 |