On Target NS5B_HCV2A 0.3188406/CHEMBL3127326
For the given ligand JJJ002, we have found in our database that, being scored 0.3188406, the most similar ligand is CHEMBL3127326. Check out the elaboration below.
| JJJ002 (Given Ligand) | CHEMBL3127326 (Similar Ligand) |
|---|---|
| O=C(Nc1ccccc1)N(Cc2ccccc2)c3ccccc3 | COC(=O)N[C@H](C(=O)N1CCC[C@H]1C(=O)Nc1ccc([C@@H]2CC[C@@H](c3ccc(NC(=O)[C@@H]4CCCN4C(=O)[C@@H](NC(=O)OC)C(C)C)cc3)N2c2ccc(C(C)(C)C)cc2)cc1)C(C)C |
|
|
|
|
|
|
| 00004006 00800000 00000100 00010e40 00000000 00000000 00000004 02003001 00000000 00000840 01280004 4000c000 00008800 00100000 00000040 00000000 00044000 02400000 08000000 00000000 c0100100 08018400 20032000 00400008 00100000 80000000 00000000 80000080 00008100 00060001 00040000 80004200 | 00014002 01003800 00100122 c4010600 20000000 0001a010 00000000 22001008 00900a00 00080ac0 08380004 4001f000 0e008812 0030a001 80020440 00120008 00062000 02080000 08002010 00000201 40100100 38048e30 20012003 0250001a 00000000 c0000002 00000000 900000a0 08008302 00060003 a0044000 00002600 |