On Target NS5B_HCV1A 0.25925925/CHEMBL3644925
For the given ligand JJJ002, we have found in our database that, being scored 0.25925925, the most similar ligand is CHEMBL3644925. Check out the elaboration below.
| JJJ002 (Given Ligand) | CHEMBL3644925 (Similar Ligand) |
|---|---|
| O=C(Nc1ccccc1)N(Cc2ccccc2)c3ccccc3 | CCC[C@H](NC(=O)[C@@H]1CN(c2ccc(-c3ccccc3)cc2)CN1C(=O)[C@@H](NC(=O)OC1CCCC1)C(C)(C)C)C(=O)C(=O)NC1CC1 |
|
|
|
|
|
|
| 00004006 00800000 00000100 00010e40 00000000 00000000 00000004 02003001 00000000 00000840 01280004 4000c000 00008800 00100000 00000040 00000000 00044000 02400000 08000000 00000000 c0100100 08018400 20032000 00400008 00100000 80000000 00000000 80000080 00008100 00060001 00040000 80004200 | 00016006 01403c00 00100120 04010f00 20080000 00018000 00000004 a0002009 04800200 00020be0 00200004 5001b000 0e00b00a 0100a101 80020040 001a0008 00860010 02482001 0c402850 00000a01 60100100 380f0e10 31020003 0250001a 00113000 80001002 00000000 102000e0 0800c200 01060013 a0184000 00006200 |