On Target CAPSD_HCV77 0.24561404/CHEMBL3645761
For the given ligand JJJ002, we have found in our database that, being scored 0.24561404, the most similar ligand is CHEMBL3645761. Check out the elaboration below.
| JJJ002 (Given Ligand) | CHEMBL3645761 (Similar Ligand) |
|---|---|
| O=C(Nc1ccccc1)N(Cc2ccccc2)c3ccccc3 | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1C[C@@]2(CN1C(=O)[C@@H](NC(=O)[C@@H](NC(=O)c1nccc3ccccc13)C1CCCCC1)C(C)(C)C)C(C)(C)C21CCC1)C(=O)NS(=O)(=O)N1CCCC1 |
|
|
|
|
|
|
| 00004006 00800000 00000100 00010e40 00000000 00000000 00000004 02003001 00000000 00000840 01280004 4000c000 00008800 00100000 00000040 00000000 00044000 02400000 08000000 00000000 c0100100 08018400 20032000 00400008 00100000 80000000 00000000 80000080 00008100 00060001 00040000 80004200 | 000180a2 09003800 06104100 15210e00 00040020 00100010 000a0000 22003409 10000000 0011c9c8 00692004 4001b000 0601881a 01502011 a0420440 02040104 04004000 02000002 46212000 00004201 40000000 38078638 20802003 b2d0003c 00100000 c0000000 00000040 90000010 08000104 c0060081 e4064004 00016260 |