On Target NA_A-H3N8 0.16853933/CHEMBL4287425
For the given ligand JJJ002, we have found in our database that, being scored 0.16853933, the most similar ligand is CHEMBL4287425. Check out the elaboration below.
| JJJ002 (Given Ligand) | CHEMBL4287425 (Similar Ligand) |
|---|---|
| O=C(Nc1ccccc1)N(Cc2ccccc2)c3ccccc3 | CCC(CC)O[C@@H]1C=C(C(=O)O)C[C@H](NCc2ccc(Sc3ccccc3)cc2)[C@H]1NC(C)=O |
|
|
|
|
|
|
| 00004006 00800000 00000100 00010e40 00000000 00000000 00000004 02003001 00000000 00000840 01280004 4000c000 00008800 00100000 00000040 00000000 00044000 02400000 08000000 00000000 c0100100 08018400 20032000 00400008 00100000 80000000 00000000 80000080 00008100 00060001 00040000 80004200 | 00070040 09807200 00120100 84110700 001c0080 00000800 02080180 3a00140a 11000000 001108c8 40200000 61019001 0402881a 01892000 00001408 00081008 14a05000 02000060 60e12010 00000201 80000020 380c8e80 13808080 02500019 10001401 c0001400 00c04000 90000001 0c000300 00060401 24060000 00810a30 |