On Target PR_FCoV 0.19672132/CHEMBL4214471
For the given ligand JJ001, we have found in our database that, being scored 0.19672132, the most similar ligand is CHEMBL4214471. Check out the elaboration below.
| JJ001 (Given Ligand) | CHEMBL4214471 (Similar Ligand) |
|---|---|
| O=C3/C(=C/c1ccccc1)S(=O)(=O)N(Cc2ccccc2)c4ccccc34 | CC(C)C[C@H](NC(=O)OC1(Cc2ccccc2)CCN(S(C)(=O)=O)CC1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 10804802 04000800 00080b02 41310602 80022081 00812942 80020081 02401400 01850010 01b91840 48302404 4008c000 0000cc80 00040001 880a0042 00028000 10868420 22109000 08218000 00014801 40100000 88028a00 24118000 0a440034 03200080 80004000 40412000 c02010cc 00488100 00060382 84048081 21010760 | 00030000 01403000 00100102 05310600 00000040 00018010 20000001 20000048 00b00a00 004a08c0 08302000 5003b000 0e00801a 00202101 81440000 001a0008 08220000 02480000 04802810 00004205 00000100 38040e70 01000081 12500018 02000001 80041002 00000000 1020002c 08000200 00060007 a0004000 00812670 |