On Target NS3_HCV1B 0.2783505/CHEMBL1170408
For the given ligand JJ001, we have found in our database that, being scored 0.2783505, the most similar ligand is CHEMBL1170408. Check out the elaboration below.
| JJ001 (Given Ligand) | CHEMBL1170408 (Similar Ligand) |
|---|---|
| O=C3/C(=C/c1ccccc1)S(=O)(=O)N(Cc2ccccc2)c4ccccc34 | C=CCCCS(=O)(=O)NC(=O)[C@H](CCC)NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)(C)C)c1ccc(Oc2cc(-c3ccccc3)nc3cc(OC)ccc23)c(C=C)c1 |
|
|
|
|
|
|
| 10804802 04000800 00080b02 41310602 80022081 00812942 80020081 02401400 01850010 01b91840 48302404 4008c000 0000cc80 00040001 880a0042 00028000 10868420 22109000 08218000 00014801 40100000 88028a00 24118000 0a440034 03200080 80004000 40412000 c02010cc 00488100 00060382 84048081 21010760 | 08012082 65c03008 20184108 15310600 00241021 00018000 96060080 22081408 20800284 105988c0 08202404 4011b000 0f00c802 00442001 c1420441 025ea00c 02020040 02082004 04282810 00465a01 c0400000 bc248e19 30800103 b3440038 02000000 c0000002 08322048 9020406c 0c404384 00260403 a4067c00 01252670 |