On Target NS5B_HCV1A 0.3/CHEMBL3644912
For the given ligand JJ001, we have found in our database that, being scored 0.3, the most similar ligand is CHEMBL3644912. Check out the elaboration below.
| JJ001 (Given Ligand) | CHEMBL3644912 (Similar Ligand) |
|---|---|
| O=C3/C(=C/c1ccccc1)S(=O)(=O)N(Cc2ccccc2)c4ccccc34 | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1CN(c2ccc(C3CCCCC3)cc2)CN1C(=O)[C@@H](NC(=O)OC1CCCC1)C(C)(C)C)C(=O)NS(=O)(=O)C1CC1 |
|
|
|
|
|
|
| 10804802 04000800 00080b02 41310602 80022081 00812942 80020081 02401400 01850010 01b91840 48302404 4008c000 0000cc80 00040001 880a0042 00028000 10868420 22109000 08218000 00014801 40100000 88028a00 24118000 0a440034 03200080 80004000 40412000 c02010cc 00488100 00060382 84048081 21010760 | 00014086 0d403c00 00100122 45310f00 20080000 00018000 000a0004 a0003409 10800a00 005a8be8 08302404 5001b000 0e00f002 0124a101 80420440 001a8008 02864010 02482000 4a612850 00004a01 60100100 bc050e10 21020003 3244003a 02112000 80001002 00000000 902000ac 08008202 81060093 a41a4000 01016670 |