On Target NS5B_HCV1B 0.348/CHEMBL3645183
For the given ligand JJ001, we have found in our database that, being scored 0.348, the most similar ligand is CHEMBL3645183. Check out the elaboration below.
| JJ001 (Given Ligand) | CHEMBL3645183 (Similar Ligand) |
|---|---|
| O=C3/C(=C/c1ccccc1)S(=O)(=O)N(Cc2ccccc2)c4ccccc34 | CCN(c1cc2nn(-c3ccc(NCC(C)C)cc3)c(C(=O)NC)c2cc1C1CC1)S(C)(=O)=O |
|
|
|
|
|
|
| 10804802 04000800 00080b02 41310602 80022081 00812942 80020081 02401400 01850010 01b91840 48302404 4008c000 0000cc80 00040001 880a0042 00028000 10868420 22109000 08218000 00014801 40100000 88028a00 24118000 0a440034 03200080 80004000 40412000 c02010cc 00488100 00060382 84048081 21010760 | 00004006 00805e08 20180902 41390e00 210c0000 00004042 02040000 0200140c 00100900 000908c0 09312024 40118800 80008c23 01400201 800a0040 000e200c 04268000 02000004 08600008 00224201 c0100101 1c878e38 20800800 8360001c 02104080 c0000040 00270080 8000108c 0c488104 0046004b c4048080 a01147e0 |