On Target NA_INFB 0.22440945/CHEMBL4175983
For the given ligand JJ001, we have found in our database that, being scored 0.22440945, the most similar ligand is CHEMBL4175983. Check out the elaboration below.
| JJ001 (Given Ligand) | CHEMBL4175983 (Similar Ligand) |
|---|---|
| O=C3/C(=C/c1ccccc1)S(=O)(=O)N(Cc2ccccc2)c4ccccc34 | CCC(CC)O[C@@H]1C=C(C(=O)O)C[C@H](NCc2ccc(N3CCCC3)cc2)[C@H]1NC(C)=O |
|
|
|
|
|
|
| 10804802 04000800 00080b02 41310602 80022081 00812942 80020081 02401400 01850010 01b91840 48302404 4008c000 0000cc80 00040001 880a0042 00028000 10868420 22109000 08218000 00014801 40100000 88028a00 24118000 0a440034 03200080 80004000 40412000 c02010cc 00488100 00060382 84048081 21010760 | 00074042 09007800 00100100 84010700 20180080 00002810 02080180 3a00140a 11000000 001108c8 40200004 41019001 0402881a 0188a000 00021448 00081008 10a44000 02000060 68c12010 00000201 40100020 38048e80 33008080 02500018 10001401 c0001400 00c04000 90000081 0c008300 00060401 24060000 00800a10 |