On Target NA_A-H3N8 0.18677042/CHEMBL4278505
For the given ligand JJ001, we have found in our database that, being scored 0.18677042, the most similar ligand is CHEMBL4278505. Check out the elaboration below.
| JJ001 (Given Ligand) | CHEMBL4278505 (Similar Ligand) |
|---|---|
| O=C3/C(=C/c1ccccc1)S(=O)(=O)N(Cc2ccccc2)c4ccccc34 | CCC(CC)O[C@@H]1C=C(C(=O)O)C[C@H](NCc2ccc(Cc3ccccc3)cc2)[C@H]1NC(C)=O |
|
|
|
|
|
|
| 10804802 04000800 00080b02 41310602 80022081 00812942 80020081 02401400 01850010 01b91840 48302404 4008c000 0000cc80 00040001 880a0042 00028000 10868420 22109000 08218000 00014801 40100000 88028a00 24118000 0a440034 03200080 80004000 40412000 c02010cc 00488100 00060382 84048081 21010760 | 00070040 09007000 00100100 84010700 00180080 00000800 02080180 3b00140a 11000100 001908c8 48200000 41019801 8402881a 01882000 00001408 00081008 10a04000 02000060 60c12010 00000201 00000020 38048e80 13008080 02500018 10001401 e0001400 00c04000 d0000001 0c000380 00060403 24060000 00800e10 |