On Target NP_HCoV-OC43 0.14720812/CHEMBL3233481
For the given ligand JJ001, we have found in our database that, being scored 0.14720812, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| JJ001 (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| O=C3/C(=C/c1ccccc1)S(=O)(=O)N(Cc2ccccc2)c4ccccc34 | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 10804802 04000800 00080b02 41310602 80022081 00812942 80020081 02401400 01850010 01b91840 48302404 4008c000 0000cc80 00040001 880a0042 00028000 10868420 22109000 08218000 00014801 40100000 88028a00 24118000 0a440034 03200080 80004000 40412000 c02010cc 00488100 00060382 84048081 21010760 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |