On Target NA_A-H3N8 0.16597511/CHEMBL4292761
For the given ligand sultam1, we have found in our database that, being scored 0.16597511, the most similar ligand is CHEMBL4292761. Check out the elaboration below.
| sultam1 (Given Ligand) | CHEMBL4292761 (Similar Ligand) |
|---|---|
| O=C2CCS(=O)(=O)N(Cc1ccccc1)c3ccccc23 | CCC(CC)O[C@@H]1C=C(C(=O)O)C[C@H](NCc2ccc(SC3CCCCC3)cc2)[C@H]1NC(C)=O |
|
|
|
|
|
|
| 10804002 25000800 00080902 01310600 80000000 00018042 00020001 02001000 00800800 00081840 08302404 4000d000 00008c02 00040001 800a0040 00020000 00068020 02100000 08204008 00404801 60100120 88828a01 20010100 00440034 06200480 80004000 40000000 8000108c 00088100 00060012 80040880 21010760 | 00070040 09807200 00120100 84110700 00180080 00000800 02080180 3a00140a 15200000 001148c8 40600000 61039001 0403881a 018d2000 02001408 00081008 14a04000 02000060 62c16010 00000201 80000020 380c8e80 13808180 02700019 10003401 c0001400 00c04000 90000001 0c000300 00060401 34060000 01810a30 |