On Target ACE2_HUMAN 0.32608697/CHEMBL401086
For the given ligand Boceprevir, we have found in our database that, being scored 0.32608697, the most similar ligand is CHEMBL401086. Check out the elaboration below.
| Boceprevir (Given Ligand) | CHEMBL401086 (Similar Ligand) |
|---|---|
| CC(C)(C)NC(=O)N[C@H](C(=O)N1C[C@H]3[C@@H]([C@H]1C(=O)NC(CC2CCC2)C(=O)C(N)=O)C3(C)C)C(C)(C)C | CC[C@@H](C)[C@H](S)C(=O)NCC(=O)O |
|
|
|
|
|
|
| 00010000 01003400 00100000 04000c00 00000000 00000010 00000004 20002008 04000000 00020180 00200000 50013000 0e00b01a 01002011 80000000 00000000 00000010 00000001 00002050 00000201 00000100 300d0630 00000003 02100018 00011000 00000000 00000000 10000000 08000000 00040011 20024000 00002200 | 00010000 01004000 00100000 00100400 00000080 00000000 80000000 20000000 00000000 02080080 00200000 40013000 06008002 00040000 80080000 00080008 10000000 00000000 00000000 00000201 00000000 10000e00 02000100 04100018 00000000 00000000 00000000 10000040 00000000 00040001 20004000 03010200 |