On Target E1_HCV77 0.52427185/CHEMBL3645608
For the given ligand Boceprevir, we have found in our database that, being scored 0.52427185, the most similar ligand is CHEMBL3645608. Check out the elaboration below.
| Boceprevir (Given Ligand) | CHEMBL3645608 (Similar Ligand) |
|---|---|
| CC(C)(C)NC(=O)N[C@H](C(=O)N1C[C@H]3[C@@H]([C@H]1C(=O)NC(CC2CCC2)C(=O)C(N)=O)C3(C)C)C(C)(C)C | CC[C@@H]1C[C@]1(NC(=O)[C@@H]1C[C@@]2(CN1C(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H]1CCCCN1C(C)C)C1CCCCC1)C(C)(C)C)C(C)(C)C21CCC1)C(=O)NS(=O)(=O)N1CCCC1 |
|
|
|
|
|
|
| 00010000 01003400 00100000 04000c00 00000000 00000010 00000004 20002008 04000000 00020180 00200000 50013000 0e00b01a 01002011 80000000 00000000 00000010 00000001 00002050 00000201 00000100 300d0630 00000003 02100018 00011000 00000000 00000000 10000000 08000000 00040011 20024000 00002200 | 000100a0 01003000 06100000 05200400 00000000 00000010 00020000 20001008 00000000 0000c180 00602000 50013000 0601801a 01002011 a0400000 00000000 04000000 00000000 06002000 00004201 00000000 30040630 00000003 32900038 00000000 00000000 00000000 10000010 08000000 40040001 60024004 00012260 |