On Target NS5B_HCV1B 0.29249012/CHEMBL3645202
For the given ligand Telaprevir, we have found in our database that, being scored 0.29249012, the most similar ligand is CHEMBL3645202. Check out the elaboration below.
| Telaprevir (Given Ligand) | CHEMBL3645202 (Similar Ligand) |
|---|---|
| CCC[C@H](NC(=O)[C@@H]2[C@H]1CCC[C@H]1CN2C(=O)[C@@H](NC(=O)[C@@H](NC(=O)c3cnccn3)C4CCCCC4)C(C)(C)C)C(=O)C(=O)NC5CC5 | CNC(=O)c1c2cc(C3CC3)c(N(CCCNC(=O)[C@H]3CCC[C@@H]3C(=O)OC)S(C)(=O)=O)cc2nn1-c1ccc(Br)cc1 |
|
|
|
|
|
|
| 10018002 01803400 00100800 14000c10 00000040 00100010 0000c000 20003009 14000000 000101a0 01290000 40013000 0e00801a 01102001 80820400 00040104 08020000 02000003 02002010 00000201 80000000 300f8e30 21004003 02100018 00141000 00000000 08000000 90000004 08000004 01060811 a0024000 80002200 | 00074006 0180de08 20180902 41310f00 211c0000 00004042 02040000 22001408 00100900 004909e0 09312024 40119800 84008c3b 01c00201 808a0040 000e200e 04a68000 02000104 08602008 00225203 e0100101 1c8b8e38 2180c800 9370001c 02104080 c0000048 00270280 9000108c 0c488306 0146005b c4068088 a8916fe0 |