On Target NA_A-H3N8 0.2682927/CHEMBL4287425
For the given ligand Telaprevir, we have found in our database that, being scored 0.2682927, the most similar ligand is CHEMBL4287425. Check out the elaboration below.
| Telaprevir (Given Ligand) | CHEMBL4287425 (Similar Ligand) |
|---|---|
| CCC[C@H](NC(=O)[C@@H]2[C@H]1CCC[C@H]1CN2C(=O)[C@@H](NC(=O)[C@@H](NC(=O)c3cnccn3)C4CCCCC4)C(C)(C)C)C(=O)C(=O)NC5CC5 | CCC(CC)O[C@@H]1C=C(C(=O)O)C[C@H](NCc2ccc(Sc3ccccc3)cc2)[C@H]1NC(C)=O |
|
|
|
|
|
|
| 10018002 01803400 00100800 14000c10 00000040 00100010 0000c000 20003009 14000000 000101a0 01290000 40013000 0e00801a 01102001 80820400 00040104 08020000 02000003 02002010 00000201 80000000 300f8e30 21004003 02100018 00141000 00000000 08000000 90000004 08000004 01060811 a0024000 80002200 | 00070040 09807200 00120100 84110700 001c0080 00000800 02080180 3a00140a 11000000 001108c8 40200000 61019001 0402881a 01892000 00001408 00081008 14a05000 02000060 60e12010 00000201 80000020 380c8e80 13808080 02500019 10001401 c0001400 00c04000 90000001 0c000300 00060401 24060000 00810a30 |