On Target NP_HCoV-OC43 0.17333333/CHEMBL3233481
For the given ligand Telaprevir, we have found in our database that, being scored 0.17333333, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| Telaprevir (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| CCC[C@H](NC(=O)[C@@H]2[C@H]1CCC[C@H]1CN2C(=O)[C@@H](NC(=O)[C@@H](NC(=O)c3cnccn3)C4CCCCC4)C(C)(C)C)C(=O)C(=O)NC5CC5 | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 10018002 01803400 00100800 14000c10 00000040 00100010 0000c000 20003009 14000000 000101a0 01290000 40013000 0e00801a 01102001 80820400 00040104 08020000 02000003 02002010 00000201 80000000 300f8e30 21004003 02100018 00141000 00000000 08000000 90000004 08000004 01060811 a0024000 80002200 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |