On Target PR_FCoV 0.08737864/CHEMBL4214066
For the given ligand Pht, we have found in our database that, being scored 0.08737864, the most similar ligand is CHEMBL4214066. Check out the elaboration below.
| Pht (Given Ligand) | CHEMBL4214066 (Similar Ligand) |
|---|---|
| C/C(=C\CO)CCCC(C)CCCC(C)CCCC(C)C | CC(C)C[C@H](NC(=O)OC1CCN(C(=O)OC(C)(C)C)CC1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00000000 00000000 00000000 08000400 00000000 00100000 00000000 40000000 00020000 00000000 00000400 00080008 00000000 00000000 00002010 00000001 00000000 00000000 00008000 00000010 00001000 00000400 00404000 80000000 00000000 00000000 24020000 00000000 | 00030000 01403000 00100100 04010600 00000000 00018010 00000001 20000008 00a00200 00020080 00200000 5003b000 0e00801a 00002101 80000000 001a0008 00220000 00080000 00802810 00000201 00000000 30140f70 01000081 02100018 00000001 00001002 00000000 10200020 08000200 00040005 a0004000 00802200 |