On Target DPM_HHV1K 0.2580645/CHEMBL29711
For the given ligand Pht, we have found in our database that, being scored 0.2580645, the most similar ligand is CHEMBL29711. Check out the elaboration below.
| Pht (Given Ligand) | CHEMBL29711 (Similar Ligand) |
|---|---|
| C/C(=C\CO)CCCC(C)CCCC(C)CCCC(C)C | C[C@]12CC[C@@H](O)[C@@](C)(CO)[C@@H]1CC[C@H]1C[C@@H]3C[C@@]12CC[C@]3(O)CO |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00000000 00000000 00000000 08000400 00000000 00100000 00000000 40000000 00020000 00000000 00000400 00080008 00000000 00000000 00002010 00000001 00000000 00000000 00008000 00000010 00001000 00000400 00404000 80000000 00000000 00000000 24020000 00000000 | 00000000 01000000 00000000 00000000 00080000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00800000 00000000 00080008 00000000 00000000 03402000 00000001 00000000 00000000 05000000 00000010 00000000 00000000 00000000 00001000 00000000 01000000 00020000 00000000 |