On Target GP_EBOV 0.51428574/CHEMBL112570
For the given ligand Pht, we have found in our database that, being scored 0.51428574, the most similar ligand is CHEMBL112570. Check out the elaboration below.
| Pht (Given Ligand) | CHEMBL112570 (Similar Ligand) |
|---|---|
| C/C(=C\CO)CCCC(C)CCCC(C)CCCC(C)C | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@@]21C |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00000000 00000000 00000000 08000400 00000000 00100000 00000000 40000000 00020000 00000000 00000400 00080008 00000000 00000000 00002010 00000001 00000000 00000000 00008000 00000010 00001000 00000400 00404000 80000000 00000000 00000000 24020000 00000000 | 00000000 01000000 00000800 00000000 00080000 00000000 00000000 00000402 00000000 00100008 00000200 40000000 00020000 00800000 00000404 00080008 00000000 00000020 02402000 00000001 00000000 00000000 01008000 00000010 00200000 00000000 00404000 80000000 00000000 01000000 24020000 00000000 |