On Target E1_HCV77 0.12612613/CHEMBL3645597
For the given ligand Pht, we have found in our database that, being scored 0.12612613, the most similar ligand is CHEMBL3645597. Check out the elaboration below.
| Pht (Given Ligand) | CHEMBL3645597 (Similar Ligand) |
|---|---|
| C/C(=C\CO)CCCC(C)CCCC(C)CCCC(C)C | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1C[C@@]2(CN1C(=O)[C@@H](NC(=O)[C@@H](NC(=O)C1CN(C(C)C)C1)C(C)(C)C)C(C)(C)C)C(C)(C)C21CCC1)C(=O)NS(=O)(=O)N1CCCC1 |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00000000 00000000 00000000 08000400 00000000 00100000 00000000 40000000 00020000 00000000 00000400 00080008 00000000 00000000 00002010 00000001 00000000 00000000 00008000 00000010 00001000 00000400 00404000 80000000 00000000 00000000 24020000 00000000 | 000100a0 09003400 06100000 05200400 00000000 00000010 000a0000 20001408 10000000 0010c1a8 00602000 40013000 0e01801a 01002011 a0400401 00000000 04004000 00000000 44012010 00004201 00000000 30040630 00000003 32900038 00001000 00000000 00000000 90000010 08000000 c0040091 64024004 00012260 |