On Target NA_A-H3N8 0.2248062/CHEMBL4292576
For the given ligand erastin, we have found in our database that, being scored 0.2248062, the most similar ligand is CHEMBL4292576. Check out the elaboration below.
| erastin (Given Ligand) | CHEMBL4292576 (Similar Ligand) |
|---|---|
| CCOc1ccccc1n5c(C(C)N3CCN(C(=O)COc2ccc(Cl)cc2)CC3)nc4ccccc4c5=O | CCC(CC)O[C@@H]1C=C(C(=O)O)C[C@H](NCc2ccc(OC)cc2)[C@H]1NC(C)=O |
|
|
|
|
|
|
| 0400a00a 00002208 20400008 14300e12 800c10e0 00104120 02009802 0000b009 06100100 400008e0 0125800c 4081c800 0280b806 00602200 011610c1 020c410c 18000018 80008402 00600000 00020000 600000c1 38078738 33800061 83300418 00102000 c0080040 20108008 00040001 0c004304 00460009 40640000 e01266a2 | 00070040 09007008 20100108 84010700 00181080 00000800 020c0180 3a00140a 11000000 001108c8 40200000 41019001 0402881a 01882000 01001409 00081008 10a04000 02000060 60c12010 00020201 00000020 38048e80 13008080 02500018 10001401 c0001400 00e24000 90000001 0c000300 00060401 24060000 00800a10 |