On Target RT_HIV1 0.25816023/CHEMBL3915855
For the given ligand erastin, we have found in our database that, being scored 0.25816023, the most similar ligand is CHEMBL3915855. Check out the elaboration below.
| erastin (Given Ligand) | CHEMBL3915855 (Similar Ligand) |
|---|---|
| CCOc1ccccc1N3CC(=O)c2ccccc2/N=C3/C(C)N5CCN(C(=O)COc4ccc(Cl)cc4)CC5 | COC(=O)N[C@H](C(=O)NCc1ccc(C(CO)N(Cc2ccnc(OC)c2)S(=O)(=O)c2ccc3scnc3c2)s1)C(c1ccccc1)c1ccccc1 |
|
|
|
|
|
|
| 0400e042 00002818 20104128 04010622 a0001088 00210000 121c0050 01420008 000002c0 00080a43 1a270004 4400ea20 12809006 40002009 811210c1 00184008 10048800 82000420 09000010 00420200 50122000 38270700 b2402023 8342881f 00893000 88100080 60900408 00000881 0c089290 00862003 80005c01 24022700 | 0003005a 55803a18 23184108 05b10601 900c10c0 00038100 04010081 2300d00e 00c60b40 004918c0 09302a04 f000b880 8e008832 00402021 a12425c1 001e062c 18423018 0219208c 00780018 0002620d e0021900 78298e90 23900000 db458058 42004800 ec010006 40100800 d000202c 0d200780 2006000f a000c000 04c107e0 |